C26H37N6O3P — CID 134260843
methyl 7-[4-[[6-(cyclohexylamino)-9-methylphosphanylpurin-2-yl]amino]phenoxy]heptanoate (PubChem CID 134260843) has the molecular formula C26H37N6O3P and a molecular weight of 512.60 g/mol. Its IUPAC name is methyl 7-[4-[[6-(cyclohexylamino)-9-methylphosphanylpurin-2-yl]amino]phenoxy]heptanoate.
| Compound Name | methyl 7-[4-[[6-(cyclohexylamino)-9-methylphosphanylpurin-2-yl]amino]phenoxy]heptanoate |
|---|---|
| PubChem CID | 134260843 |
| Molecular Formula | C26H37N6O3P |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | methyl 7-[4-[[6-(cyclohexylamino)-9-methylphosphanylpurin-2-yl]amino]phenoxy]heptanoate |
| SMILES | COC(=O)CCCCCCOc1ccc(Nc2nc(NC3CCCCC3)c3ncn(PC)c3n2)cc1 |
| InChI | InChI=1S/C26H37N6O3P/c1-34-22(33)12-8-3-4-9-17-35-21-15-13-20(14-16-21)29-26-30-24(28-19-10-6-5-7-11-19)23-25(31-26)32(36-2)18-27-23/h13-16,18-19,36H,3-12,17H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | ZGUWOAQWOFSLSL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|