C27H40IN6O2PS — CID 144961981
ethane;methyl 7-[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]phenyl]sulfanylheptanoate (PubChem CID 144961981) has the molecular formula C27H40IN6O2PS and a molecular weight of 670.60 g/mol. Its IUPAC name is ethane;methyl 7-[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]phenyl]sulfanylheptanoate.
| Compound Name | ethane;methyl 7-[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]phenyl]sulfanylheptanoate |
|---|---|
| PubChem CID | 144961981 |
| Molecular Formula | C27H40IN6O2PS |
| Molecular Weight | 670.60 g/mol |
| Exact Mass | 670.17 |
| IUPAC Name | ethane;methyl 7-[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]phenyl]sulfanylheptanoate |
| SMILES | CC.COC(=O)CCCCCCSc1ccc(Nc2nc(NC3CCCCC3)c3ncn(PI)c3n2)cc1 |
| InChI | InChI=1S/C25H34IN6O2PS.C2H6/c1-34-21(33)11-7-2-3-8-16-36-20-14-12-19(13-15-20)29-25-30-23(28-18-9-5-4-6-10-18)22-24(31-25)32(35-26)17-27-22;1-2/h12-15,17-18,35H,2-11,16H2,1H3,(H2,28,29,30,31);1-2H3 |
| InChIKey | XOBNPBULKVMZNZ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.60 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|