C24H31IN7O3P — CID 144961945
6-[[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]benzoyl]amino]hexanoic acid (PubChem CID 144961945) has the molecular formula C24H31IN7O3P and a molecular weight of 623.44 g/mol. Its IUPAC name is 6-[[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]benzoyl]amino]hexanoic acid.
| Compound Name | 6-[[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 144961945 |
| Molecular Formula | C24H31IN7O3P |
| Molecular Weight | 623.44 g/mol |
| Exact Mass | 623.13 |
| IUPAC Name | 6-[[4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]benzoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1ccc(Nc2nc(NC3CCCCC3)c3ncn(PI)c3n2)cc1 |
| InChI | InChI=1S/C24H31IN7O3P/c25-36-32-15-27-20-21(28-17-7-3-1-4-8-17)30-24(31-22(20)32)29-18-12-10-16(11-13-18)23(35)26-14-6-2-5-9-19(33)34/h10-13,15,17,36H,1-9,14H2,(H,26,35)(H,33,34)(H2,28,29,30,31) |
| InChIKey | HLMUFVNIDYBKOP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|