C24H31IN7O2P — CID 144961967
4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]-N-(6-oxohexyl)benzamide (PubChem CID 144961967) has the molecular formula C24H31IN7O2P and a molecular weight of 607.44 g/mol. Its IUPAC name is 4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]-N-(6-oxohexyl)benzamide.
| Compound Name | 4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]-N-(6-oxohexyl)benzamide |
|---|---|
| PubChem CID | 144961967 |
| Molecular Formula | C24H31IN7O2P |
| Molecular Weight | 607.44 g/mol |
| Exact Mass | 607.13 |
| IUPAC Name | 4-[[6-(cyclohexylamino)-9-iodophosphanylpurin-2-yl]amino]-N-(6-oxohexyl)benzamide |
| SMILES | O=CCCCCCNC(=O)c1ccc(Nc2nc(NC3CCCCC3)c3ncn(PI)c3n2)cc1 |
| InChI | InChI=1S/C24H31IN7O2P/c25-35-32-16-27-20-21(28-18-8-4-3-5-9-18)30-24(31-22(20)32)29-19-12-10-17(11-13-19)23(34)26-14-6-1-2-7-15-33/h10-13,15-16,18,35H,1-9,14H2,(H,26,34)(H2,28,29,30,31) |
| InChIKey | PEVDLIDABRDQFF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|