C26H40N8O — CID 173224325
5-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]pent-4-enal (PubChem CID 173224325) has the molecular formula C26H40N8O and a molecular weight of 480.66 g/mol. Its IUPAC name is 5-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]pent-4-enal.
| Compound Name | 5-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]pent-4-enal |
|---|---|
| PubChem CID | 173224325 |
| Molecular Formula | C26H40N8O |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | 5-[4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]piperidin-1-yl]pent-4-enal |
| SMILES | NC1CCC(Nc2nc(NC3CCN(C=CCCC=O)CC3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C26H40N8O/c27-19-8-10-20(11-9-19)30-26-31-24(23-25(32-26)34(18-28-23)22-6-2-3-7-22)29-21-12-15-33(16-13-21)14-4-1-5-17-35/h4,14,17-22H,1-3,5-13,15-16,27H2,(H2,29,30,31,32) |
| InChIKey | PZYSUNWBXPZIFQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|