C26H36IN6O3P — CID 126710743
methyl 7-[4-[[6-[cyclohexyl(methyl)amino]-9-iodophosphanylpurin-2-yl]amino]phenoxy]heptanoate (PubChem CID 126710743) has the molecular formula C26H36IN6O3P and a molecular weight of 638.49 g/mol. Its IUPAC name is methyl 7-[4-[[6-[cyclohexyl(methyl)amino]-9-iodophosphanylpurin-2-yl]amino]phenoxy]heptanoate.
| Compound Name | methyl 7-[4-[[6-[cyclohexyl(methyl)amino]-9-iodophosphanylpurin-2-yl]amino]phenoxy]heptanoate |
|---|---|
| PubChem CID | 126710743 |
| Molecular Formula | C26H36IN6O3P |
| Molecular Weight | 638.49 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | methyl 7-[4-[[6-[cyclohexyl(methyl)amino]-9-iodophosphanylpurin-2-yl]amino]phenoxy]heptanoate |
| SMILES | COC(=O)CCCCCCOc1ccc(Nc2nc(N(C)C3CCCCC3)c3ncn(PI)c3n2)cc1 |
| InChI | InChI=1S/C26H36IN6O3P/c1-32(20-10-6-5-7-11-20)24-23-25(33(37-27)18-28-23)31-26(30-24)29-19-13-15-21(16-14-19)36-17-9-4-3-8-12-22(34)35-2/h13-16,18,20,37H,3-12,17H2,1-2H3,(H,29,30,31) |
| InChIKey | BHTXCTQPJWJQJO-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.49 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|