C26H40I2N8O3P2 — CID 144961958
ethane;7-[4-[[9-iodophosphanyl-6-[(1-methylpiperidin-4-yl)amino]purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide (PubChem CID 144961958) has the molecular formula C26H40I2N8O3P2 and a molecular weight of 828.41 g/mol. Its IUPAC name is ethane;7-[4-[[9-iodophosphanyl-6-[(1-methylpiperidin-4-yl)amino]purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide.
| Compound Name | ethane;7-[4-[[9-iodophosphanyl-6-[(1-methylpiperidin-4-yl)amino]purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide |
|---|---|
| PubChem CID | 144961958 |
| Molecular Formula | C26H40I2N8O3P2 |
| Molecular Weight | 828.41 g/mol |
| Exact Mass | 828.08 |
| IUPAC Name | ethane;7-[4-[[9-iodophosphanyl-6-[(1-methylpiperidin-4-yl)amino]purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide |
| SMILES | CC.CN1CCC(Nc2nc(Nc3ccc(OCCCCCCC(=O)NOPI)cc3)nc3c2ncn3PI)CC1 |
| InChI | InChI=1S/C24H34I2N8O3P2.C2H6/c1-33-13-11-18(12-14-33)28-22-21-23(34(38-25)16-27-21)31-24(30-22)29-17-7-9-19(10-8-17)36-15-5-3-2-4-6-20(35)32-37-39-26;1-2/h7-10,16,18,38-39H,2-6,11-15H2,1H3,(H,32,35)(H2,28,29,30,31);1-2H3 |
| InChIKey | PHMGVFZKXQQKRS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.41 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|