C25H30IN6O3P — CID 144961977
7-[4-[[6-(cyclohexa-1,5-dien-1-ylmethyl)-7H-purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide (PubChem CID 144961977) has the molecular formula C25H30IN6O3P and a molecular weight of 620.43 g/mol. Its IUPAC name is 7-[4-[[6-(cyclohexa-1,5-dien-1-ylmethyl)-7H-purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide.
| Compound Name | 7-[4-[[6-(cyclohexa-1,5-dien-1-ylmethyl)-7H-purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide |
|---|---|
| PubChem CID | 144961977 |
| Molecular Formula | C25H30IN6O3P |
| Molecular Weight | 620.43 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | 7-[4-[[6-(cyclohexa-1,5-dien-1-ylmethyl)-7H-purin-2-yl]amino]phenoxy]-N-iodophosphanyloxyheptanamide |
| SMILES | O=C(CCCCCCOc1ccc(Nc2nc(CC3=CCCC=C3)c3[nH]cnc3n2)cc1)NOPI |
| InChI | InChI=1S/C25H30IN6O3P/c26-36-35-32-22(33)10-6-1-2-7-15-34-20-13-11-19(12-14-20)29-25-30-21(16-18-8-4-3-5-9-18)23-24(31-25)28-17-27-23/h4,8-9,11-14,17,36H,1-3,5-7,10,15-16H2,(H,32,33)(H2,27,28,29,30,31) |
| InChIKey | LNNYCYBXVGQXIK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|