C21H29N7O3 — CID 118518111
N-hydroxy-5-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]pentanamide (PubChem CID 118518111) has the molecular formula C21H29N7O3 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-hydroxy-5-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]pentanamide.
| Compound Name | N-hydroxy-5-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]pentanamide |
|---|---|
| PubChem CID | 118518111 |
| Molecular Formula | C21H29N7O3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-hydroxy-5-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]pentanamide |
| SMILES | CCCC(C)Nc1nc(Nc2ccc(OCCCCC(=O)NO)cc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C21H29N7O3/c1-3-6-14(2)24-20-18-19(23-13-22-18)26-21(27-20)25-15-8-10-16(11-9-15)31-12-5-4-7-17(29)28-30/h8-11,13-14,30H,3-7,12H2,1-2H3,(H,28,29)(H3,22,23,24,25,26,27) |
| InChIKey | YFXDOCWSPAWEJM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|