C22H31N7O3 — CID 118518128
7-[4-[[6-(diethylamino)-7H-purin-2-yl]amino]phenoxy]-N-hydroxyheptanamide (PubChem CID 118518128) has the molecular formula C22H31N7O3 and a molecular weight of 441.54 g/mol. Its IUPAC name is 7-[4-[[6-(diethylamino)-7H-purin-2-yl]amino]phenoxy]-N-hydroxyheptanamide.
| Compound Name | 7-[4-[[6-(diethylamino)-7H-purin-2-yl]amino]phenoxy]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 118518128 |
| Molecular Formula | C22H31N7O3 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 7-[4-[[6-(diethylamino)-7H-purin-2-yl]amino]phenoxy]-N-hydroxyheptanamide |
| SMILES | CCN(CC)c1nc(Nc2ccc(OCCCCCCC(=O)NO)cc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C22H31N7O3/c1-3-29(4-2)21-19-20(24-15-23-19)26-22(27-21)25-16-10-12-17(13-11-16)32-14-8-6-5-7-9-18(30)28-31/h10-13,15,31H,3-9,14H2,1-2H3,(H,28,30)(H2,23,24,25,26,27) |
| InChIKey | YBJCFAWHBWQATF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|