C29H30N6 — CID 118420609
6-N,6-N-dibenzyl-2-N-(4-butylphenyl)-7H-purine-2,6-diamine (PubChem CID 118420609) has the molecular formula C29H30N6 and a molecular weight of 462.60 g/mol. Its IUPAC name is 6-N,6-N-dibenzyl-2-N-(4-butylphenyl)-7H-purine-2,6-diamine.
| Compound Name | 6-N,6-N-dibenzyl-2-N-(4-butylphenyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 118420609 |
| Molecular Formula | C29H30N6 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 6-N,6-N-dibenzyl-2-N-(4-butylphenyl)-7H-purine-2,6-diamine |
| SMILES | CCCCc1ccc(Nc2nc(N(Cc3ccccc3)Cc3ccccc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C29H30N6/c1-2-3-10-22-15-17-25(18-16-22)32-29-33-27-26(30-21-31-27)28(34-29)35(19-23-11-6-4-7-12-23)20-24-13-8-5-9-14-24/h4-9,11-18,21H,2-3,10,19-20H2,1H3,(H2,30,31,32,33,34) |
| InChIKey | CEHHULHCIZCUBI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |