C15H17N5S — CID 3005246
2-(4-butylanilino)-3,7-dihydropurine-6-thione (PubChem CID 3005246) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-(4-butylanilino)-3,7-dihydropurine-6-thione.
| Compound Name | 2-(4-butylanilino)-3,7-dihydropurine-6-thione |
|---|---|
| PubChem CID | 3005246 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(4-butylanilino)-3,7-dihydropurine-6-thione |
| SMILES | CCCCc1ccc(Nc2nc(=S)c3[nH]cnc3[nH]2)cc1 |
| InChI | InChI=1S/C15H17N5S/c1-2-3-4-10-5-7-11(8-6-10)18-15-19-13-12(14(21)20-15)16-9-17-13/h5-9H,2-4H2,1H3,(H3,16,17,18,19,20,21) |
| InChIKey | JWQSQZFFXQPOJJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|