C8H11N5S — CID 134817853
2-(propan-2-ylamino)-3,7-dihydropurine-6-thione (PubChem CID 134817853) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is 2-(propan-2-ylamino)-3,7-dihydropurine-6-thione.
| Compound Name | 2-(propan-2-ylamino)-3,7-dihydropurine-6-thione |
|---|---|
| PubChem CID | 134817853 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(propan-2-ylamino)-3,7-dihydropurine-6-thione |
| SMILES | CC(C)Nc1nc(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C8H11N5S/c1-4(2)11-8-12-6-5(7(14)13-8)9-3-10-6/h3-4H,1-2H3,(H3,9,10,11,12,13,14) |
| InChIKey | WHOFQVDAKJDEDM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|