C5H11N6O3PS2 — CID 175097785
2-amino-3,7-dihydropurine-6-thione;aminophosphonic acid;sulfane (PubChem CID 175097785) has the molecular formula C5H11N6O3PS2 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-thione;aminophosphonic acid;sulfane.
| Compound Name | 2-amino-3,7-dihydropurine-6-thione;aminophosphonic acid;sulfane |
|---|---|
| PubChem CID | 175097785 |
| Molecular Formula | C5H11N6O3PS2 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-thione;aminophosphonic acid;sulfane |
| SMILES | NP(=O)(O)O.Nc1nc(=S)c2[nH]cnc2[nH]1.S |
| InChI | InChI=1S/C5H5N5S.H4NO3P.H2S/c6-5-9-3-2(4(11)10-5)7-1-8-3;1-5(2,3)4;/h1H,(H4,6,7,8,9,10,11);(H4,1,2,3,4);1H2 |
| InChIKey | OILARHLUUWFRID-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|