C5H5N5S — CID 156593677
2-amino-3,7-dihydropurine-6-thione (PubChem CID 156593677) has the molecular formula C5H5N5S and a molecular weight of 171.17 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-thione.
| Compound Name | 2-amino-3,7-dihydropurine-6-thione |
|---|---|
| PubChem CID | 156593677 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-thione |
| SMILES | Nc1nc(=S)c2[15nH][13cH][15n][13c]2[nH]1 |
| InChI | InChI=1S/C5H5N5S/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)/i1+1,3+1,7+1,8+1 |
| InChIKey | WYWHKKSPHMUBEB-LRHOFRIRSA-N |
| XLogP | 0.60 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|