C10H9N9S2 — CID 87073730
2-amino-3,7-dihydropurine-6-thione;3,7-dihydropurine-2-thione (PubChem CID 87073730) has the molecular formula C10H9N9S2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-thione;3,7-dihydropurine-2-thione.
| Compound Name | 2-amino-3,7-dihydropurine-6-thione;3,7-dihydropurine-2-thione |
|---|---|
| PubChem CID | 87073730 |
| Molecular Formula | C10H9N9S2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-thione;3,7-dihydropurine-2-thione |
| SMILES | Nc1nc(=S)c2[nH]cnc2[nH]1.S=c1ncc2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H5N5S.C5H4N4S/c6-5-9-3-2(4(11)10-5)7-1-8-3;10-5-6-1-3-4(9-5)8-2-7-3/h1H,(H4,6,7,8,9,10,11);1-2H,(H2,6,7,8,9,10) |
| InChIKey | QAIUQRMHMACFFU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|