About 3,7-dihydropurine-6-thione;platinum
3,7-dihydropurine-6-thione;platinum (PubChem CID 71358741) has the molecular formula C5H4N4PtS
and a molecular weight of 347.26 g/mol. Its IUPAC name is 3,7-dihydropurine-6-thione;platinum.
Molecular Properties
| Compound Name | 3,7-dihydropurine-6-thione;platinum |
| PubChem CID | 71358741 |
| Molecular Formula | C5H4N4PtS |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 3,7-dihydropurine-6-thione;platinum |
| SMILES | S=c1nc[nH]c2nc[nH]c12.[Pt] |
| InChI | InChI=1S/C5H4N4S.Pt/c10-5-3-4(7-1-6-3)8-2-9-5;/h1-2H,(H2,6,7,8,9,10); |
| InChIKey | NAJYNUNOFZLWCX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dihydropurine-6-thione;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydropurine-6-thione;platinum?
The IUPAC name of 3,7-dihydropurine-6-thione;platinum (CID 71358741) is 3,7-dihydropurine-6-thione;platinum.
What is the SMILES notation for 3,7-dihydropurine-6-thione;platinum?
The canonical SMILES for 3,7-dihydropurine-6-thione;platinum is S=c1nc[nH]c2nc[nH]c12.[Pt].
What is the InChIKey of 3,7-dihydropurine-6-thione;platinum?
The InChIKey is NAJYNUNOFZLWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4S.Pt/c10-5-3-4(7-1-6-3)8-2-9-5;/h1-2H,(H2,6,7,8,9,10);.
What are the key properties of 3,7-dihydropurine-6-thione;platinum?
3,7-dihydropurine-6-thione;platinum has a molecular weight of 347.26 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydropurine-6-thione;platinum is sourced from PubChem (CID 71358741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).