C5H4N4S — CID 667490
3,7-dihydropurine-6-thione (PubChem CID 667490) has the molecular formula C5H4N4S and a molecular weight of 152.18 g/mol. Its IUPAC name is 3,7-dihydropurine-6-thione.
| Compound Name | 3,7-dihydropurine-6-thione |
|---|---|
| PubChem CID | 667490 |
| Molecular Formula | C5H4N4S |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 3,7-dihydropurine-6-thione |
| SMILES | S=c1nc[nH]c2nc[nH]c12 |
| InChI | InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
| InChIKey | GLVAUDGFNGKCSF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|