C5H5N5S — CID 2723601
2-amino-3,7-dihydropurine-6-thione (PubChem CID 2723601) has the molecular formula C5H5N5S and a molecular weight of 167.20 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-thione.
| Compound Name | 2-amino-3,7-dihydropurine-6-thione |
|---|---|
| PubChem CID | 2723601 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-thione |
| SMILES | Nc1nc(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H5N5S/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) |
| InChIKey | WYWHKKSPHMUBEB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|