C7H9N5S — CID 4995062
2-(ethylamino)-3,7-dihydropurine-6-thione (PubChem CID 4995062) has the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-(ethylamino)-3,7-dihydropurine-6-thione.
| Compound Name | 2-(ethylamino)-3,7-dihydropurine-6-thione |
|---|---|
| PubChem CID | 4995062 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-(ethylamino)-3,7-dihydropurine-6-thione |
| SMILES | CCNc1nc(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C7H9N5S/c1-2-8-7-11-5-4(6(13)12-7)9-3-10-5/h3H,2H2,1H3,(H3,8,9,10,11,12,13) |
| InChIKey | GSWPBKWDDAQMIQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|