About 2-(ethylamino)-3,7-dihydropurine-6-thione
2-(ethylamino)-3,7-dihydropurine-6-thione (PubChem CID 4995062) has the molecular formula C7H9N5S
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-(ethylamino)-3,7-dihydropurine-6-thione.
Molecular Properties
| Compound Name | 2-(ethylamino)-3,7-dihydropurine-6-thione |
| PubChem CID | 4995062 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-(ethylamino)-3,7-dihydropurine-6-thione |
| SMILES | CCNc1nc(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C7H9N5S/c1-2-8-7-11-5-4(6(13)12-7)9-3-10-5/h3H,2H2,1H3,(H3,8,9,10,11,12,13) |
| InChIKey | GSWPBKWDDAQMIQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylamino)-3,7-dihydropurine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-3,7-dihydropurine-6-thione?
The IUPAC name of 2-(ethylamino)-3,7-dihydropurine-6-thione (CID 4995062) is 2-(ethylamino)-3,7-dihydropurine-6-thione.
What is the SMILES notation for 2-(ethylamino)-3,7-dihydropurine-6-thione?
The canonical SMILES for 2-(ethylamino)-3,7-dihydropurine-6-thione is CCNc1nc(=S)c2[nH]cnc2[nH]1.
What is the InChIKey of 2-(ethylamino)-3,7-dihydropurine-6-thione?
The InChIKey is GSWPBKWDDAQMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5S/c1-2-8-7-11-5-4(6(13)12-7)9-3-10-5/h3H,2H2,1H3,(H3,8,9,10,11,12,13).
What are the key properties of 2-(ethylamino)-3,7-dihydropurine-6-thione?
2-(ethylamino)-3,7-dihydropurine-6-thione has a molecular weight of 195.25 g/mol, XLogP of 1.45, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-3,7-dihydropurine-6-thione is sourced from PubChem (CID 4995062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).