C10H17N5O4S — CID 156733964
2-amino-3,7-dihydropurine-6-thione;methanol;oxolane-3,4-diol (PubChem CID 156733964) has the molecular formula C10H17N5O4S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-thione;methanol;oxolane-3,4-diol.
| Compound Name | 2-amino-3,7-dihydropurine-6-thione;methanol;oxolane-3,4-diol |
|---|---|
| PubChem CID | 156733964 |
| Molecular Formula | C10H17N5O4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-thione;methanol;oxolane-3,4-diol |
| SMILES | CO.Nc1nc(=S)c2[nH]cnc2[nH]1.OC1COCC1O |
| InChI | InChI=1S/C5H5N5S.C4H8O3.CH4O/c6-5-9-3-2(4(11)10-5)7-1-8-3;5-3-1-7-2-4(3)6;1-2/h1H,(H4,6,7,8,9,10,11);3-6H,1-2H2;2H,1H3 |
| InChIKey | YNYLNWVCDGXGFB-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|