C11H11N7OS — CID 87370042
2-amino-3,7-dihydropurine-6-thione;pyridine-3-carboxamide (PubChem CID 87370042) has the molecular formula C11H11N7OS and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-amino-3,7-dihydropurine-6-thione;pyridine-3-carboxamide.
| Compound Name | 2-amino-3,7-dihydropurine-6-thione;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87370042 |
| Molecular Formula | C11H11N7OS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-amino-3,7-dihydropurine-6-thione;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.Nc1nc(=S)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C6H6N2O.C5H5N5S/c7-6(9)5-2-1-3-8-4-5;6-5-9-3-2(4(11)10-5)7-1-8-3/h1-4H,(H2,7,9);1H,(H4,6,7,8,9,10,11) |
| InChIKey | BATGRBMPRGJUMM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|