About 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide
6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide (PubChem CID 129308158) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide |
| PubChem CID | 129308158 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C6H6N2O.C4H5N3O/c7-6(9)5-2-1-3-8-4-5;5-3-1-2-6-4(8)7-3/h1-4H,(H2,7,9);1-2H,(H3,5,6,7,8) |
| InChIKey | QQAKOGZYSUCKHD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide?
The IUPAC name of 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide (CID 129308158) is 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide.
What is the SMILES notation for 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide?
The canonical SMILES for 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide is NC(=O)c1cccnc1.Nc1ccnc(=O)[nH]1.
What is the InChIKey of 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide?
The InChIKey is QQAKOGZYSUCKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C4H5N3O/c7-6(9)5-2-1-3-8-4-5;5-3-1-2-6-4(8)7-3/h1-4H,(H2,7,9);1-2H,(H3,5,6,7,8).
What are the key properties of 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide?
6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide has a molecular weight of 233.23 g/mol, XLogP of -0.47, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1H-pyrimidin-2-one;pyridine-3-carboxamide is sourced from PubChem (CID 129308158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).