C9H12N4S — CID 21115589
6-butyl-1,7-dihydropurine-2-thione (PubChem CID 21115589) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is 6-butyl-1,7-dihydropurine-2-thione.
| Compound Name | 6-butyl-1,7-dihydropurine-2-thione |
|---|---|
| PubChem CID | 21115589 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 6-butyl-1,7-dihydropurine-2-thione |
| SMILES | CCCCc1[nH]c(=S)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H12N4S/c1-2-3-4-6-7-8(11-5-10-7)13-9(14)12-6/h5H,2-4H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | OXHDLSKGCBAQMW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|