C13H24N2 — CID 66778912
4,5-dipentyl-1H-imidazole (PubChem CID 66778912) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 4,5-dipentyl-1H-imidazole.
| Compound Name | 4,5-dipentyl-1H-imidazole |
|---|---|
| PubChem CID | 66778912 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4,5-dipentyl-1H-imidazole |
| SMILES | CCCCCc1nc[nH]c1CCCCC |
| InChI | InChI=1S/C13H24N2/c1-3-5-7-9-12-13(15-11-14-12)10-8-6-4-2/h11H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | BVYIRHNTUGXQPF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|