C26H45N3O — CID 160507940
4,5-di(nonyl)-1H-imidazole;1H-pyridin-2-one (PubChem CID 160507940) has the molecular formula C26H45N3O and a molecular weight of 415.67 g/mol. Its IUPAC name is 4,5-di(nonyl)-1H-imidazole;1H-pyridin-2-one.
| Compound Name | 4,5-di(nonyl)-1H-imidazole;1H-pyridin-2-one |
|---|---|
| PubChem CID | 160507940 |
| Molecular Formula | C26H45N3O |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | 4,5-di(nonyl)-1H-imidazole;1H-pyridin-2-one |
| SMILES | CCCCCCCCCc1nc[nH]c1CCCCCCCCC.O=c1cccc[nH]1 |
| InChI | InChI=1S/C21H40N2.C5H5NO/c1-3-5-7-9-11-13-15-17-20-21(23-19-22-20)18-16-14-12-10-8-6-4-2;7-5-3-1-2-4-6-5/h19H,3-18H2,1-2H3,(H,22,23);1-4H,(H,6,7) |
| InChIKey | QSQVINBZTAEWBQ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|