C29H43NO5 — CID 175778873
dioctyl benzene-1,2-dicarboxylate;1H-pyridin-2-one (PubChem CID 175778873) has the molecular formula C29H43NO5 and a molecular weight of 485.67 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;1H-pyridin-2-one.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;1H-pyridin-2-one |
|---|---|
| PubChem CID | 175778873 |
| Molecular Formula | C29H43NO5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;1H-pyridin-2-one |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.O=c1cccc[nH]1 |
| InChI | InChI=1S/C24H38O4.C5H5NO/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;7-5-3-1-2-4-6-5/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-4H,(H,6,7) |
| InChIKey | COJGPYMZVGHMEB-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|