About CID 161334491
CID 161334491 (PubChem CID 161334491) has the molecular formula C31H43BN2
and a molecular weight of 454.51 g/mol.
Molecular Properties
| Compound Name | CID 161334491 |
| PubChem CID | 161334491 |
| Molecular Formula | C31H43BN2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | — |
| SMILES | CCCCCc1nc[nH]c1CCCCC.[B]CCC=CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19B.C13H24N2/c19-15-9-3-8-14-18(16-10-4-1-5-11-16)17-12-6-2-7-13-17;1-3-5-7-9-12-13(15-11-14-12)10-8-6-4-2/h1-8,10-13,18H,9,14-15H2;11H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | GJCVKLFZXORTTC-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 161334491 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161334491?
The IUPAC name of CID 161334491 (CID 161334491) is not available.
What is the SMILES notation for CID 161334491?
The canonical SMILES for CID 161334491 is CCCCCc1nc[nH]c1CCCCC.[B]CCC=CCC(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 161334491?
The InChIKey is GJCVKLFZXORTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19B.C13H24N2/c19-15-9-3-8-14-18(16-10-4-1-5-11-16)17-12-6-2-7-13-17;1-3-5-7-9-12-13(15-11-14-12)10-8-6-4-2/h1-8,10-13,18H,9,14-15H2;11H,3-10H2,1-2H3,(H,14,15).
What are the key properties of CID 161334491?
CID 161334491 has a molecular weight of 454.51 g/mol, XLogP of 8.62, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161334491 is sourced from PubChem (CID 161334491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).