C29H41BF2N2 — CID 67927722
4,5-dihexyl-1H-imidazole;ethyl-bis(3-fluorophenyl)borane (PubChem CID 67927722) has the molecular formula C29H41BF2N2 and a molecular weight of 466.47 g/mol. Its IUPAC name is 4,5-dihexyl-1H-imidazole;ethyl-bis(3-fluorophenyl)borane.
| Compound Name | 4,5-dihexyl-1H-imidazole;ethyl-bis(3-fluorophenyl)borane |
|---|---|
| PubChem CID | 67927722 |
| Molecular Formula | C29H41BF2N2 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 4,5-dihexyl-1H-imidazole;ethyl-bis(3-fluorophenyl)borane |
| SMILES | CCB(c1cccc(F)c1)c1cccc(F)c1.CCCCCCc1nc[nH]c1CCCCCC |
| InChI | InChI=1S/C15H28N2.C14H13BF2/c1-3-5-7-9-11-14-15(17-13-16-14)12-10-8-6-4-2;1-2-15(11-5-3-7-13(16)9-11)12-6-4-8-14(17)10-12/h13H,3-12H2,1-2H3,(H,16,17);3-10H,2H2,1H3 |
| InChIKey | ICVKMTHUWLRNKK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|