C22H25FN6 — CID 66632887
N-[2-(7-fluoro-2-hexylquinolin-3-yl)ethyl]-7H-purin-6-amine (PubChem CID 66632887) has the molecular formula C22H25FN6 and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[2-(7-fluoro-2-hexylquinolin-3-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[2-(7-fluoro-2-hexylquinolin-3-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 66632887 |
| Molecular Formula | C22H25FN6 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[2-(7-fluoro-2-hexylquinolin-3-yl)ethyl]-7H-purin-6-amine |
| SMILES | CCCCCCc1nc2cc(F)ccc2cc1CCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C22H25FN6/c1-2-3-4-5-6-18-16(11-15-7-8-17(23)12-19(15)29-18)9-10-24-21-20-22(26-13-25-20)28-14-27-21/h7-8,11-14H,2-6,9-10H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | UEFWFLMGWAUJKK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|