C24H21FN6 — CID 87328911
N-[2-[5-ethyl-8-(3-fluorophenyl)quinolin-7-yl]ethyl]-7H-purin-6-amine (PubChem CID 87328911) has the molecular formula C24H21FN6 and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[2-[5-ethyl-8-(3-fluorophenyl)quinolin-7-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[2-[5-ethyl-8-(3-fluorophenyl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 87328911 |
| Molecular Formula | C24H21FN6 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[2-[5-ethyl-8-(3-fluorophenyl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
| SMILES | CCc1cc(CCNc2ncnc3nc[nH]c23)c(-c2cccc(F)c2)c2ncccc12 |
| InChI | InChI=1S/C24H21FN6/c1-2-15-11-17(8-10-27-23-22-24(29-13-28-22)31-14-30-23)20(16-5-3-6-18(25)12-16)21-19(15)7-4-9-26-21/h3-7,9,11-14H,2,8,10H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | DNKNNVVWJFODEA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |