C20H20FN7O — CID 67247766
(3R)-1-[5-fluoro-7-[2-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol (PubChem CID 67247766) has the molecular formula C20H20FN7O and a molecular weight of 393.43 g/mol. Its IUPAC name is (3R)-1-[5-fluoro-7-[2-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[5-fluoro-7-[2-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 67247766 |
| Molecular Formula | C20H20FN7O |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3R)-1-[5-fluoro-7-[2-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(c2c(CCNc3ncnc4nc[nH]c34)cc(F)c3cccnc23)C1 |
| InChI | InChI=1S/C20H20FN7O/c21-15-8-12(3-6-23-19-17-20(25-10-24-17)27-11-26-19)18(28-7-4-13(29)9-28)16-14(15)2-1-5-22-16/h1-2,5,8,10-11,13,29H,3-4,6-7,9H2,(H2,23,24,25,26,27)/t13-/m1/s1 |
| InChIKey | SJWGADNUMVHSRB-CYBMUJFWSA-N |
| XLogP | 2.27 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |