C21H22ClN7O — CID 53251192
N-[1-[5-chloro-8-(3-methoxypyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine (PubChem CID 53251192) has the molecular formula C21H22ClN7O and a molecular weight of 423.91 g/mol. Its IUPAC name is N-[1-[5-chloro-8-(3-methoxypyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[5-chloro-8-(3-methoxypyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 53251192 |
| Molecular Formula | C21H22ClN7O |
| Molecular Weight | 423.91 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[1-[5-chloro-8-(3-methoxypyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
| SMILES | COC1CCN(c2c(C(C)Nc3ncnc4nc[nH]c34)cc(Cl)c3cccnc23)C1 |
| InChI | InChI=1S/C21H22ClN7O/c1-12(28-21-18-20(25-10-24-18)26-11-27-21)15-8-16(22)14-4-3-6-23-17(14)19(15)29-7-5-13(9-29)30-2/h3-4,6,8,10-13H,5,7,9H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | SXUQDSNSGWVAKG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |