C20H20ClN7O — CID 76736168
1-[5-chloro-7-[1-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol (PubChem CID 76736168) has the molecular formula C20H20ClN7O and a molecular weight of 409.88 g/mol. Its IUPAC name is 1-[5-chloro-7-[1-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol.
| Compound Name | 1-[5-chloro-7-[1-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 76736168 |
| Molecular Formula | C20H20ClN7O |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-[5-chloro-7-[1-(7H-purin-6-ylamino)ethyl]quinolin-8-yl]pyrrolidin-3-ol |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc(Cl)c2cccnc2c1N1CCC(O)C1 |
| InChI | InChI=1S/C20H20ClN7O/c1-11(27-20-17-19(24-9-23-17)25-10-26-20)14-7-15(21)13-3-2-5-22-16(13)18(14)28-6-4-12(29)8-28/h2-3,5,7,9-12,29H,4,6,8H2,1H3,(H2,23,24,25,26,27) |
| InChIKey | AUFOAAVMUQEDED-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |