C26H24ClN7 — CID 53251354
N-[1-[5-chloro-8-(3-phenylpyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine (PubChem CID 53251354) has the molecular formula C26H24ClN7 and a molecular weight of 469.98 g/mol. Its IUPAC name is N-[1-[5-chloro-8-(3-phenylpyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[5-chloro-8-(3-phenylpyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 53251354 |
| Molecular Formula | C26H24ClN7 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[1-[5-chloro-8-(3-phenylpyrrolidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc(Cl)c2cccnc2c1N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C26H24ClN7/c1-16(33-26-23-25(30-14-29-23)31-15-32-26)20-12-21(27)19-8-5-10-28-22(19)24(20)34-11-9-18(13-34)17-6-3-2-4-7-17/h2-8,10,12,14-16,18H,9,11,13H2,1H3,(H2,29,30,31,32,33) |
| InChIKey | VIYRJISZQMHZGF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |