C21H21ClFN7 — CID 53250859
N-[1-[5-chloro-8-(3-fluoropiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine (PubChem CID 53250859) has the molecular formula C21H21ClFN7 and a molecular weight of 425.90 g/mol. Its IUPAC name is N-[1-[5-chloro-8-(3-fluoropiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[5-chloro-8-(3-fluoropiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 53250859 |
| Molecular Formula | C21H21ClFN7 |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[1-[5-chloro-8-(3-fluoropiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc(Cl)c2cccnc2c1N1CCCC(F)C1 |
| InChI | InChI=1S/C21H21ClFN7/c1-12(29-21-18-20(26-10-25-18)27-11-28-21)15-8-16(22)14-5-2-6-24-17(14)19(15)30-7-3-4-13(23)9-30/h2,5-6,8,10-13H,3-4,7,9H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | TYGRAMOZBBLFAY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |