C27H26ClN7 — CID 53251195
N-[1-[5-chloro-8-(4-phenylpiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine (PubChem CID 53251195) has the molecular formula C27H26ClN7 and a molecular weight of 484.01 g/mol. Its IUPAC name is N-[1-[5-chloro-8-(4-phenylpiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[5-chloro-8-(4-phenylpiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 53251195 |
| Molecular Formula | C27H26ClN7 |
| Molecular Weight | 484.01 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-[1-[5-chloro-8-(4-phenylpiperidin-1-yl)quinolin-7-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc(Cl)c2cccnc2c1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H26ClN7/c1-17(34-27-24-26(31-15-30-24)32-16-33-27)21-14-22(28)20-8-5-11-29-23(20)25(21)35-12-9-19(10-13-35)18-6-3-2-4-7-18/h2-8,11,14-17,19H,9-10,12-13H2,1H3,(H2,30,31,32,33,34) |
| InChIKey | GKOAOJKZHODBGJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.01 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |