C15H14ClFN6 — CID 133438868
N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-7H-purin-6-amine (PubChem CID 133438868) has the molecular formula C15H14ClFN6 and a molecular weight of 332.77 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-7H-purin-6-amine.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 133438868 |
| Molecular Formula | C15H14ClFN6 |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)pyrrolidin-3-yl]-7H-purin-6-amine |
| SMILES | Fc1ccc(N2CCC(Nc3ncnc4nc[nH]c34)C2)cc1Cl |
| InChI | InChI=1S/C15H14ClFN6/c16-11-5-10(1-2-12(11)17)23-4-3-9(6-23)22-15-13-14(19-7-18-13)20-8-21-15/h1-2,5,7-9H,3-4,6H2,(H2,18,19,20,21,22) |
| InChIKey | VCJHJYBSFLSVRY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |