C13H18N6 — CID 133320076
N-(1-prop-2-enylpiperidin-4-yl)-7H-purin-6-amine (PubChem CID 133320076) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is N-(1-prop-2-enylpiperidin-4-yl)-7H-purin-6-amine.
| Compound Name | N-(1-prop-2-enylpiperidin-4-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 133320076 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | N-(1-prop-2-enylpiperidin-4-yl)-7H-purin-6-amine |
| SMILES | C=CCN1CCC(Nc2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C13H18N6/c1-2-5-19-6-3-10(4-7-19)18-13-11-12(15-8-14-11)16-9-17-13/h2,8-10H,1,3-7H2,(H2,14,15,16,17,18) |
| InChIKey | ZNBOTAIIYFXWNZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|