C9H11N5 — CID 131020883
N-[(1R,2R)-2-methylcyclopropyl]-7H-purin-6-amine (PubChem CID 131020883) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclopropyl]-7H-purin-6-amine.
| Compound Name | N-[(1R,2R)-2-methylcyclopropyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 131020883 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclopropyl]-7H-purin-6-amine |
| SMILES | C[C@@H]1C[C@H]1Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H11N5/c1-5-2-6(5)14-9-7-8(11-3-10-7)12-4-13-9/h3-6H,2H2,1H3,(H2,10,11,12,13,14)/t5-,6-/m1/s1 |
| InChIKey | KKVNLONOIVUPAN-PHDIDXHHSA-N |
| XLogP | 1.17 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |