C10H13N5 — CID 61223491
N-(2,2-dimethylcyclopropyl)-7H-purin-6-amine (PubChem CID 61223491) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopropyl)-7H-purin-6-amine.
| Compound Name | N-(2,2-dimethylcyclopropyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 61223491 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-(2,2-dimethylcyclopropyl)-7H-purin-6-amine |
| SMILES | CC1(C)CC1Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C10H13N5/c1-10(2)3-6(10)15-9-7-8(12-4-11-7)13-5-14-9/h4-6H,3H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | OYFBMVJQTPBPKQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |