C9H12N6 — CID 140997133
N-[(3S)-pyrrolidin-3-yl]-7H-purin-6-amine (PubChem CID 140997133) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is N-[(3S)-pyrrolidin-3-yl]-7H-purin-6-amine.
| Compound Name | N-[(3S)-pyrrolidin-3-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 140997133 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | N-[(3S)-pyrrolidin-3-yl]-7H-purin-6-amine |
| SMILES | c1nc(N[C@H]2CCNC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H12N6/c1-2-10-3-6(1)15-9-7-8(12-4-11-7)13-5-14-9/h4-6,10H,1-3H2,(H2,11,12,13,14,15)/t6-/m0/s1 |
| InChIKey | LUCBOLOHLRBDRN-LURJTMIESA-N |
| XLogP | 0.13 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |