C12H16N6 — CID 167769299
2-N-(7H-purin-6-yl)spiro[3.3]heptane-2,6-diamine (PubChem CID 167769299) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-N-(7H-purin-6-yl)spiro[3.3]heptane-2,6-diamine.
| Compound Name | 2-N-(7H-purin-6-yl)spiro[3.3]heptane-2,6-diamine |
|---|---|
| PubChem CID | 167769299 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-N-(7H-purin-6-yl)spiro[3.3]heptane-2,6-diamine |
| SMILES | NC1CC2(C1)CC(Nc1ncnc3nc[nH]c13)C2 |
| InChI | InChI=1S/C12H16N6/c13-7-1-12(2-7)3-8(4-12)18-11-9-10(15-5-14-9)16-6-17-11/h5-8H,1-4,13H2,(H2,14,15,16,17,18) |
| InChIKey | SYKYTLVFISSKQG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |