C13H19N5O — CID 95971222
N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-7H-purin-6-amine (PubChem CID 95971222) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-7H-purin-6-amine.
| Compound Name | N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 95971222 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-7H-purin-6-amine |
| SMILES | CO[C@@]1(C)C[C@@H](Nc2ncnc3nc[nH]c23)C1(C)C |
| InChI | InChI=1S/C13H19N5O/c1-12(2)8(5-13(12,3)19-4)18-11-9-10(15-6-14-9)16-7-17-11/h6-8H,5H2,1-4H3,(H2,14,15,16,17,18)/t8-,13+/m1/s1 |
| InChIKey | DUHMXAMFXYLEAH-OQPBUACISA-N |
| XLogP | 1.97 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |