C10H14N6 — CID 24689570
N-piperidin-4-yl-7H-purin-6-amine (PubChem CID 24689570) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-piperidin-4-yl-7H-purin-6-amine.
| Compound Name | N-piperidin-4-yl-7H-purin-6-amine |
|---|---|
| PubChem CID | 24689570 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N-piperidin-4-yl-7H-purin-6-amine |
| SMILES | c1nc(NC2CCNCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H14N6/c1-3-11-4-2-7(1)16-10-8-9(13-5-12-8)14-6-15-10/h5-7,11H,1-4H2,(H2,12,13,14,15,16) |
| InChIKey | MEELCBFVGZUKIO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |