C10H13N5S — CID 62255046
6-piperidin-4-ylsulfanyl-7H-purine (PubChem CID 62255046) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is 6-piperidin-4-ylsulfanyl-7H-purine.
| Compound Name | 6-piperidin-4-ylsulfanyl-7H-purine |
|---|---|
| PubChem CID | 62255046 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 6-piperidin-4-ylsulfanyl-7H-purine |
| SMILES | c1nc(SC2CCNCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H13N5S/c1-3-11-4-2-7(1)16-10-8-9(13-5-12-8)14-6-15-10/h5-7,11H,1-4H2,(H,12,13,14,15) |
| InChIKey | SPSRXDIAHZNSOA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |