C12H16N6OS — CID 62544731
1-piperazin-1-yl-3-(7H-purin-6-ylsulfanyl)propan-1-one (PubChem CID 62544731) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-(7H-purin-6-ylsulfanyl)propan-1-one.
| Compound Name | 1-piperazin-1-yl-3-(7H-purin-6-ylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 62544731 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-piperazin-1-yl-3-(7H-purin-6-ylsulfanyl)propan-1-one |
| SMILES | O=C(CCSc1ncnc2nc[nH]c12)N1CCNCC1 |
| InChI | InChI=1S/C12H16N6OS/c19-9(18-4-2-13-3-5-18)1-6-20-12-10-11(15-7-14-10)16-8-17-12/h7-8,13H,1-6H2,(H,14,15,16,17) |
| InChIKey | URNROUOJUPDZNH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |