C11H15N5OS — CID 64633862
N-methyl-3-(7H-purin-6-ylsulfanyl)oxan-4-amine (PubChem CID 64633862) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is N-methyl-3-(7H-purin-6-ylsulfanyl)oxan-4-amine.
| Compound Name | N-methyl-3-(7H-purin-6-ylsulfanyl)oxan-4-amine |
|---|---|
| PubChem CID | 64633862 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-methyl-3-(7H-purin-6-ylsulfanyl)oxan-4-amine |
| SMILES | CNC1CCOCC1Sc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H15N5OS/c1-12-7-2-3-17-4-8(7)18-11-9-10(14-5-13-9)15-6-16-11/h5-8,12H,2-4H2,1H3,(H,13,14,15,16) |
| InChIKey | AOPQTUNTMNUTJN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |