C14H15N5S — CID 64633270
N-methyl-1-phenyl-2-(7H-purin-6-ylsulfanyl)ethanamine (PubChem CID 64633270) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is N-methyl-1-phenyl-2-(7H-purin-6-ylsulfanyl)ethanamine.
| Compound Name | N-methyl-1-phenyl-2-(7H-purin-6-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 64633270 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-methyl-1-phenyl-2-(7H-purin-6-ylsulfanyl)ethanamine |
| SMILES | CNC(CSc1ncnc2nc[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C14H15N5S/c1-15-11(10-5-3-2-4-6-10)7-20-14-12-13(17-8-16-12)18-9-19-14/h2-6,8-9,11,15H,7H2,1H3,(H,16,17,18,19) |
| InChIKey | VMBPHTIORGHZFQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |