C31H32N6OS — CID 15031176
1-[4-[phenyl-(4-phenylphenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-2-ol (PubChem CID 15031176) has the molecular formula C31H32N6OS and a molecular weight of 536.71 g/mol. Its IUPAC name is 1-[4-[phenyl-(4-phenylphenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-2-ol.
| Compound Name | 1-[4-[phenyl-(4-phenylphenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 15031176 |
| Molecular Formula | C31H32N6OS |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 1-[4-[phenyl-(4-phenylphenyl)methyl]piperazin-1-yl]-3-(7H-purin-6-ylsulfanyl)propan-2-ol |
| SMILES | OC(CSc1ncnc2nc[nH]c12)CN1CCN(C(c2ccccc2)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C31H32N6OS/c38-27(20-39-31-28-30(33-21-32-28)34-22-35-31)19-36-15-17-37(18-16-36)29(25-9-5-2-6-10-25)26-13-11-24(12-14-26)23-7-3-1-4-8-23/h1-14,21-22,27,29,38H,15-20H2,(H,32,33,34,35) |
| InChIKey | UONUVYUFBWWHFK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |